C12H21IS2 — CID 10689611
(1E,3Z)-1,4-bis(tert-butylsulfanyl)-1-iodobuta-1,3-diene (PubChem CID 10689611) has the molecular formula C12H21IS2 and a molecular weight of 356.34 g/mol. Its IUPAC name is (1E,3Z)-1,4-bis(tert-butylsulfanyl)-1-iodobuta-1,3-diene.
| Compound Name | (1E,3Z)-1,4-bis(tert-butylsulfanyl)-1-iodobuta-1,3-diene |
|---|---|
| PubChem CID | 10689611 |
| Molecular Formula | C12H21IS2 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | (1E,3Z)-1,4-bis(tert-butylsulfanyl)-1-iodobuta-1,3-diene |
| SMILES | CC(C)(C)S/C=C\C=C(\I)SC(C)(C)C |
| InChI | InChI=1S/C12H21IS2/c1-11(2,3)14-9-7-8-10(13)15-12(4,5)6/h7-9H,1-6H3/b9-7-,10-8- |
| InChIKey | YAHCRIKCOPDQLH-XOHWUJONSA-N |
| XLogP | 5.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|