C24H23ClO3 — CID 160873759
1,6-dimethyl-1H-indene-2-carbonyl chloride;1,6-dimethyl-1H-indene-2-carboxylic acid (PubChem CID 160873759) has the molecular formula C24H23ClO3 and a molecular weight of 394.90 g/mol. Its IUPAC name is 1,6-dimethyl-1H-indene-2-carbonyl chloride;1,6-dimethyl-1H-indene-2-carboxylic acid.
| Compound Name | 1,6-dimethyl-1H-indene-2-carbonyl chloride;1,6-dimethyl-1H-indene-2-carboxylic acid |
|---|---|
| PubChem CID | 160873759 |
| Molecular Formula | C24H23ClO3 |
| Molecular Weight | 394.90 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 1,6-dimethyl-1H-indene-2-carbonyl chloride;1,6-dimethyl-1H-indene-2-carboxylic acid |
| SMILES | Cc1ccc2c(c1)C(C)C(C(=O)Cl)=C2.Cc1ccc2c(c1)C(C)C(C(=O)O)=C2 |
| InChI | InChI=1S/C12H11ClO.C12H12O2/c2*1-7-3-4-9-6-11(12(13)14)8(2)10(9)5-7/h3-6,8H,1-2H3;3-6,8H,1-2H3,(H,13,14) |
| InChIKey | SMCMCNHKHQKYLL-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.90 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|