C28H22F3N4O3+ — CID 160875185
5-[3,3-dimethyl-2-oxo-1-(1-oxopyrazol-1-ium-3-yl)indol-4-yl]-N-(4-methylphenyl)-2-(trifluoromethyl)benzamide (PubChem CID 160875185) has the molecular formula C28H22F3N4O3+ and a molecular weight of 519.50 g/mol. Its IUPAC name is 5-[3,3-dimethyl-2-oxo-1-(1-oxopyrazol-1-ium-3-yl)indol-4-yl]-N-(4-methylphenyl)-2-(trifluoromethyl)benzamide.
| Compound Name | 5-[3,3-dimethyl-2-oxo-1-(1-oxopyrazol-1-ium-3-yl)indol-4-yl]-N-(4-methylphenyl)-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 160875185 |
| Molecular Formula | C28H22F3N4O3+ |
| Molecular Weight | 519.50 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | 5-[3,3-dimethyl-2-oxo-1-(1-oxopyrazol-1-ium-3-yl)indol-4-yl]-N-(4-methylphenyl)-2-(trifluoromethyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2cc(-c3cccc4c3C(C)(C)C(=O)N4C3=N[N+](=O)C=C3)ccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C28H21F3N4O3/c1-16-7-10-18(11-8-16)32-25(36)20-15-17(9-12-21(20)28(29,30)31)19-5-4-6-22-24(19)27(2,3)26(37)35(22)23-13-14-34(38)33-23/h4-15H,1-3H3/p+1 |
| InChIKey | VJQUHBUZQDWAOQ-UHFFFAOYSA-O |
| XLogP | 6.18 |
| TPSA | 81.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.50 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|