C28H19F5N3O+ — CID 159838768
5-[3-(2,3-difluorophenyl)-3aH-pyrazolo[1,5-a]pyridin-8-ium-7-yl]-N-(4-methylphenyl)-2-(trifluoromethyl)benzamide (PubChem CID 159838768) has the molecular formula C28H19F5N3O+ and a molecular weight of 508.47 g/mol. Its IUPAC name is 5-[3-(2,3-difluorophenyl)-3aH-pyrazolo[1,5-a]pyridin-8-ium-7-yl]-N-(4-methylphenyl)-2-(trifluoromethyl)benzamide.
| Compound Name | 5-[3-(2,3-difluorophenyl)-3aH-pyrazolo[1,5-a]pyridin-8-ium-7-yl]-N-(4-methylphenyl)-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 159838768 |
| Molecular Formula | C28H19F5N3O+ |
| Molecular Weight | 508.47 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | 5-[3-(2,3-difluorophenyl)-3aH-pyrazolo[1,5-a]pyridin-8-ium-7-yl]-N-(4-methylphenyl)-2-(trifluoromethyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2cc(C3=CC=CC4C(c5cccc(F)c5F)=CN=[N+]34)ccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C28H18F5N3O/c1-16-8-11-18(12-9-16)35-27(37)20-14-17(10-13-22(20)28(31,32)33)24-6-3-7-25-21(15-34-36(24)25)19-4-2-5-23(29)26(19)30/h2-15,25H,1H3/p+1 |
| InChIKey | TWORIGJFPMZFGN-UHFFFAOYSA-O |
| XLogP | 7.34 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.47 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|