C32H45BN4O6 — CID 160880065
tert-butyl 6-[1-[(1S,3R)-3-azidocyclopentanecarbonyl]azetidin-3-yl]oxy-3-[2-[(1S,2S,6R,8S)-9,9-dimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-methylbenzoate (PubChem CID 160880065) has the molecular formula C32H45BN4O6 and a molecular weight of 592.55 g/mol. Its IUPAC name is tert-butyl 6-[1-[(1S,3R)-3-azidocyclopentanecarbonyl]azetidin-3-yl]oxy-3-[2-[(1S,2S,6R,8S)-9,9-dimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-methylbenzoate.
| Compound Name | tert-butyl 6-[1-[(1S,3R)-3-azidocyclopentanecarbonyl]azetidin-3-yl]oxy-3-[2-[(1S,2S,6R,8S)-9,9-dimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-methylbenzoate |
|---|---|
| PubChem CID | 160880065 |
| Molecular Formula | C32H45BN4O6 |
| Molecular Weight | 592.55 g/mol |
| Exact Mass | 592.34 |
| IUPAC Name | tert-butyl 6-[1-[(1S,3R)-3-azidocyclopentanecarbonyl]azetidin-3-yl]oxy-3-[2-[(1S,2S,6R,8S)-9,9-dimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-methylbenzoate |
| SMILES | Cc1c(CCB2O[C@H]3[C@H]4C[C@@H](C[C@H]3O2)C4(C)C)ccc(OC2CN(C(=O)[C@H]3CC[C@@H](N=[N+]=[N-])C3)C2)c1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H45BN4O6/c1-18-19(11-12-33-42-26-15-21-14-24(28(26)43-33)32(21,5)6)8-10-25(27(18)30(39)41-31(2,3)4)40-23-16-37(17-23)29(38)20-7-9-22(13-20)35-36-34/h8,10,20-24,26,28H,7,9,11-17H2,1-6H3/t20-,21-,22+,24+,26+,28-/m0/s1 |
| InChIKey | SMXKNIFCFPOWBN-ZTQBNSSLSA-N |
| XLogP | 5.90 |
| TPSA | 123.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.55 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|