C26H54O2S2Sn — CID 160888444
dioctyltin;[6-methyl-1,1-bis(sulfanyl)heptyl] acetate (PubChem CID 160888444) has the molecular formula C26H54O2S2Sn and a molecular weight of 581.56 g/mol. Its IUPAC name is dioctyltin;[6-methyl-1,1-bis(sulfanyl)heptyl] acetate.
| Compound Name | dioctyltin;[6-methyl-1,1-bis(sulfanyl)heptyl] acetate |
|---|---|
| PubChem CID | 160888444 |
| Molecular Formula | C26H54O2S2Sn |
| Molecular Weight | 581.56 g/mol |
| Exact Mass | 582.26 |
| IUPAC Name | dioctyltin;[6-methyl-1,1-bis(sulfanyl)heptyl] acetate |
| SMILES | CC(=O)OC(S)(S)CCCCC(C)C.CCCCCCCC[Sn]CCCCCCCC |
| InChI | InChI=1S/C10H20O2S2.2C8H17.Sn/c1-8(2)6-4-5-7-10(13,14)12-9(3)11;2*1-3-5-7-8-6-4-2;/h8,13-14H,4-7H2,1-3H3;2*1,3-8H2,2H3; |
| InChIKey | SNYHGTSBKABCLY-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.56 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|