C12H30N2O3Si — CID 160890336
4-[diethoxy(methyl)silyl]oxy-1-N,1-N-dimethylpentane-1,4-diamine (PubChem CID 160890336) has the molecular formula C12H30N2O3Si and a molecular weight of 278.47 g/mol. Its IUPAC name is 4-[diethoxy(methyl)silyl]oxy-1-N,1-N-dimethylpentane-1,4-diamine.
| Compound Name | 4-[diethoxy(methyl)silyl]oxy-1-N,1-N-dimethylpentane-1,4-diamine |
|---|---|
| PubChem CID | 160890336 |
| Molecular Formula | C12H30N2O3Si |
| Molecular Weight | 278.47 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 4-[diethoxy(methyl)silyl]oxy-1-N,1-N-dimethylpentane-1,4-diamine |
| SMILES | CCO[Si](C)(OCC)OC(C)(N)CCCN(C)C |
| InChI | InChI=1S/C12H30N2O3Si/c1-7-15-18(6,16-8-2)17-12(3,13)10-9-11-14(4)5/h7-11,13H2,1-6H3 |
| InChIKey | SOEKVBCTZPLESZ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.47 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|