C30H45N3O — CID 160896516
2-(benzotriazol-2-yl)-1-[(8R,13S,17S)-3,3,8,10,13-pentamethyl-2,4,5,6,7,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanol (PubChem CID 160896516) has the molecular formula C30H45N3O and a molecular weight of 463.71 g/mol. Its IUPAC name is 2-(benzotriazol-2-yl)-1-[(8R,13S,17S)-3,3,8,10,13-pentamethyl-2,4,5,6,7,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanol.
| Compound Name | 2-(benzotriazol-2-yl)-1-[(8R,13S,17S)-3,3,8,10,13-pentamethyl-2,4,5,6,7,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanol |
|---|---|
| PubChem CID | 160896516 |
| Molecular Formula | C30H45N3O |
| Molecular Weight | 463.71 g/mol |
| Exact Mass | 463.36 |
| IUPAC Name | 2-(benzotriazol-2-yl)-1-[(8R,13S,17S)-3,3,8,10,13-pentamethyl-2,4,5,6,7,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanol |
| SMILES | CC1(C)CCC2(C)C(CC[C@]3(C)C2CC[C@@]2(C)C3CC[C@@H]2C(O)Cn2nc3ccccc3n2)C1 |
| InChI | InChI=1S/C30H45N3O/c1-27(2)16-17-28(3)20(18-27)12-14-30(5)25-11-10-21(29(25,4)15-13-26(28)30)24(34)19-33-31-22-8-6-7-9-23(22)32-33/h6-9,20-21,24-26,34H,10-19H2,1-5H3/t20?,21-,24?,25?,26?,28?,29-,30+/m1/s1 |
| InChIKey | SOYFYWZVPIEIKB-QFUIRYGOSA-N |
| XLogP | 6.87 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.71 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |