About 2-bromoheptane
2-bromoheptane (PubChem CID 16090) has the molecular formula C7H15Br
and a molecular weight of 179.10 g/mol. Its IUPAC name is 2-bromoheptane.
Molecular Properties
| Compound Name | 2-bromoheptane |
| PubChem CID | 16090 |
| Molecular Formula | C7H15Br |
| Molecular Weight | 179.10 g/mol |
| Exact Mass | 178.04 |
| IUPAC Name | 2-bromoheptane |
| SMILES | CCCCCC(C)Br |
| InChI | InChI=1S/C7H15Br/c1-3-4-5-6-7(2)8/h7H,3-6H2,1-2H3 |
| InChIKey | HLAUCEOFCOXKNF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.10 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromoheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromoheptane?
The IUPAC name of 2-bromoheptane (CID 16090) is 2-bromoheptane.
What is the SMILES notation for 2-bromoheptane?
The canonical SMILES for 2-bromoheptane is CCCCCC(C)Br.
What is the InChIKey of 2-bromoheptane?
The InChIKey is HLAUCEOFCOXKNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15Br/c1-3-4-5-6-7(2)8/h7H,3-6H2,1-2H3.
What are the key properties of 2-bromoheptane?
2-bromoheptane has a molecular weight of 179.10 g/mol, XLogP of 3.35, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromoheptane is sourced from PubChem (CID 16090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).