About 2-bromohexane
2-bromohexane (PubChem CID 18805) has the molecular formula C6H13Br
and a molecular weight of 165.07 g/mol. Its IUPAC name is 2-bromohexane.
Molecular Properties
| Compound Name | 2-bromohexane |
| PubChem CID | 18805 |
| Molecular Formula | C6H13Br |
| Molecular Weight | 165.07 g/mol |
| Exact Mass | 164.02 |
| IUPAC Name | 2-bromohexane |
| SMILES | CCCCC(C)Br |
| InChI | InChI=1S/C6H13Br/c1-3-4-5-6(2)7/h6H,3-5H2,1-2H3 |
| InChIKey | NEBYCXAKZCQWAW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.07 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromohexane?
The IUPAC name of 2-bromohexane (CID 18805) is 2-bromohexane.
What is the SMILES notation for 2-bromohexane?
The canonical SMILES for 2-bromohexane is CCCCC(C)Br.
What is the InChIKey of 2-bromohexane?
The InChIKey is NEBYCXAKZCQWAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13Br/c1-3-4-5-6(2)7/h6H,3-5H2,1-2H3.
What are the key properties of 2-bromohexane?
2-bromohexane has a molecular weight of 165.07 g/mol, XLogP of 2.96, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromohexane is sourced from PubChem (CID 18805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).