About 2-bromobutane
2-bromobutane (PubChem CID 6554) has the molecular formula C4H9Br
and a molecular weight of 137.02 g/mol. Its IUPAC name is 2-bromobutane.
Molecular Properties
| Compound Name | 2-bromobutane |
| PubChem CID | 6554 |
| Molecular Formula | C4H9Br |
| Molecular Weight | 137.02 g/mol |
| Exact Mass | 135.99 |
| IUPAC Name | 2-bromobutane |
| SMILES | CCC(C)Br |
| InChI | InChI=1S/C4H9Br/c1-3-4(2)5/h4H,3H2,1-2H3 |
| InChIKey | UPSXAPQYNGXVBF-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.02 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromobutane?
The IUPAC name of 2-bromobutane (CID 6554) is 2-bromobutane.
What is the SMILES notation for 2-bromobutane?
The canonical SMILES for 2-bromobutane is CCC(C)Br.
What is the InChIKey of 2-bromobutane?
The InChIKey is UPSXAPQYNGXVBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9Br/c1-3-4(2)5/h4H,3H2,1-2H3.
What are the key properties of 2-bromobutane?
2-bromobutane has a molecular weight of 137.02 g/mol, XLogP of 2.18, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromobutane is sourced from PubChem (CID 6554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).