C19H16FN3O2 — CID 160904999
N-[(3-fluorophenyl)methyl]-1-methyl-6-oxo-5-pyridin-2-ylpyridine-3-carboxamide (PubChem CID 160904999) has the molecular formula C19H16FN3O2 and a molecular weight of 337.35 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-1-methyl-6-oxo-5-pyridin-2-ylpyridine-3-carboxamide.
| Compound Name | N-[(3-fluorophenyl)methyl]-1-methyl-6-oxo-5-pyridin-2-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 160904999 |
| Molecular Formula | C19H16FN3O2 |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-1-methyl-6-oxo-5-pyridin-2-ylpyridine-3-carboxamide |
| SMILES | Cn1cc(C(=O)NCc2cccc(F)c2)cc(-c2ccccn2)c1=O |
| InChI | InChI=1S/C19H16FN3O2/c1-23-12-14(10-16(19(23)25)17-7-2-3-8-21-17)18(24)22-11-13-5-4-6-15(20)9-13/h2-10,12H,11H2,1H3,(H,22,24) |
| InChIKey | SQAFIIIYSIAVOX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |