C17H31N3O4 — CID 160906598
4-methyldecan-1-amine;1-methylpyrazole-4,5-dicarboxylic acid (PubChem CID 160906598) has the molecular formula C17H31N3O4 and a molecular weight of 341.45 g/mol. Its IUPAC name is 4-methyldecan-1-amine;1-methylpyrazole-4,5-dicarboxylic acid.
| Compound Name | 4-methyldecan-1-amine;1-methylpyrazole-4,5-dicarboxylic acid |
|---|---|
| PubChem CID | 160906598 |
| Molecular Formula | C17H31N3O4 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.23 |
| IUPAC Name | 4-methyldecan-1-amine;1-methylpyrazole-4,5-dicarboxylic acid |
| SMILES | CCCCCCC(C)CCCN.Cn1ncc(C(=O)O)c1C(=O)O |
| InChI | InChI=1S/C11H25N.C6H6N2O4/c1-3-4-5-6-8-11(2)9-7-10-12;1-8-4(6(11)12)3(2-7-8)5(9)10/h11H,3-10,12H2,1-2H3;2H,1H3,(H,9,10)(H,11,12) |
| InChIKey | SQFNALPOUMOQGW-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|