C8H10N2O5S — CID 117218926
5-ethylsulfonylcarbonyl-1-methylpyrazole-4-carboxylic acid (PubChem CID 117218926) has the molecular formula C8H10N2O5S and a molecular weight of 246.24 g/mol. Its IUPAC name is 5-ethylsulfonylcarbonyl-1-methylpyrazole-4-carboxylic acid.
| Compound Name | 5-ethylsulfonylcarbonyl-1-methylpyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 117218926 |
| Molecular Formula | C8H10N2O5S |
| Molecular Weight | 246.24 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | 5-ethylsulfonylcarbonyl-1-methylpyrazole-4-carboxylic acid |
| SMILES | CCS(=O)(=O)C(=O)c1c(C(=O)O)cnn1C |
| InChI | InChI=1S/C8H10N2O5S/c1-3-16(14,15)8(13)6-5(7(11)12)4-9-10(6)2/h4H,3H2,1-2H3,(H,11,12) |
| InChIKey | QVKVSXYXSLNWQX-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.24 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|