C20H22FN5O4 — CID 160907081
4-[[(1R,2S,3R)-2,3-dihydroxycyclopentyl]amino]-N-[(5-fluoro-2-methoxyphenyl)methyl]-7H-pyrrolo[3,4-d]pyrimidine-5-carboxamide (PubChem CID 160907081) has the molecular formula C20H22FN5O4 and a molecular weight of 415.43 g/mol. Its IUPAC name is 4-[[(1R,2S,3R)-2,3-dihydroxycyclopentyl]amino]-N-[(5-fluoro-2-methoxyphenyl)methyl]-7H-pyrrolo[3,4-d]pyrimidine-5-carboxamide.
| Compound Name | 4-[[(1R,2S,3R)-2,3-dihydroxycyclopentyl]amino]-N-[(5-fluoro-2-methoxyphenyl)methyl]-7H-pyrrolo[3,4-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 160907081 |
| Molecular Formula | C20H22FN5O4 |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 4-[[(1R,2S,3R)-2,3-dihydroxycyclopentyl]amino]-N-[(5-fluoro-2-methoxyphenyl)methyl]-7H-pyrrolo[3,4-d]pyrimidine-5-carboxamide |
| SMILES | COc1ccc(F)cc1CNC(=O)C1=NCc2ncnc(N[C@@H]3CC[C@@H](O)[C@H]3O)c21 |
| InChI | InChI=1S/C20H22FN5O4/c1-30-15-5-2-11(21)6-10(15)7-23-20(29)17-16-13(8-22-17)24-9-25-19(16)26-12-3-4-14(27)18(12)28/h2,5-6,9,12,14,18,27-28H,3-4,7-8H2,1H3,(H,23,29)(H,24,25,26)/t12-,14-,18+/m1/s1 |
| InChIKey | OYUOPMOAQYOCGK-DFHBCGBQSA-N |
| XLogP | 0.54 |
| TPSA | 128.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |