C18H17F3N6O2 — CID 126666996
N-[(2,5-difluorophenyl)methyl]-4-[[(1S,2R,3S)-3-fluoro-2-hydroxycyclopentyl]amino]-2H-pyrazolo[3,4-d]pyrimidine-3-carboxamide (PubChem CID 126666996) has the molecular formula C18H17F3N6O2 and a molecular weight of 406.37 g/mol. Its IUPAC name is N-[(2,5-difluorophenyl)methyl]-4-[[(1S,2R,3S)-3-fluoro-2-hydroxycyclopentyl]amino]-2H-pyrazolo[3,4-d]pyrimidine-3-carboxamide.
| Compound Name | N-[(2,5-difluorophenyl)methyl]-4-[[(1S,2R,3S)-3-fluoro-2-hydroxycyclopentyl]amino]-2H-pyrazolo[3,4-d]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 126666996 |
| Molecular Formula | C18H17F3N6O2 |
| Molecular Weight | 406.37 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | N-[(2,5-difluorophenyl)methyl]-4-[[(1S,2R,3S)-3-fluoro-2-hydroxycyclopentyl]amino]-2H-pyrazolo[3,4-d]pyrimidine-3-carboxamide |
| SMILES | O=C(NCc1cc(F)ccc1F)c1[nH]nc2ncnc(N[C@H]3CC[C@H](F)[C@@H]3O)c12 |
| InChI | InChI=1S/C18H17F3N6O2/c19-9-1-2-10(20)8(5-9)6-22-18(29)14-13-16(23-7-24-17(13)27-26-14)25-12-4-3-11(21)15(12)28/h1-2,5,7,11-12,15,28H,3-4,6H2,(H,22,29)(H2,23,24,25,26,27)/t11-,12-,15-/m0/s1 |
| InChIKey | CMPKYIOCUOXKJG-HUBLWGQQSA-N |
| XLogP | 1.83 |
| TPSA | 115.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.37 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |