C19H18F2N6O2 — CID 126666527
N-[(2,5-difluorophenyl)methyl]-4-[[(1R,2R,3R)-2-hydroxy-3-bicyclo[3.1.0]hexanyl]amino]-2H-pyrazolo[3,4-d]pyrimidine-3-carboxamide (PubChem CID 126666527) has the molecular formula C19H18F2N6O2 and a molecular weight of 400.39 g/mol. Its IUPAC name is N-[(2,5-difluorophenyl)methyl]-4-[[(1R,2R,3R)-2-hydroxy-3-bicyclo[3.1.0]hexanyl]amino]-2H-pyrazolo[3,4-d]pyrimidine-3-carboxamide.
| Compound Name | N-[(2,5-difluorophenyl)methyl]-4-[[(1R,2R,3R)-2-hydroxy-3-bicyclo[3.1.0]hexanyl]amino]-2H-pyrazolo[3,4-d]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 126666527 |
| Molecular Formula | C19H18F2N6O2 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | N-[(2,5-difluorophenyl)methyl]-4-[[(1R,2R,3R)-2-hydroxy-3-bicyclo[3.1.0]hexanyl]amino]-2H-pyrazolo[3,4-d]pyrimidine-3-carboxamide |
| SMILES | O=C(NCc1cc(F)ccc1F)c1[nH]nc2ncnc(N[C@@H]3CC4C[C@H]4[C@H]3O)c12 |
| InChI | InChI=1S/C19H18F2N6O2/c20-10-1-2-12(21)9(3-10)6-22-19(29)15-14-17(23-7-24-18(14)27-26-15)25-13-5-8-4-11(8)16(13)28/h1-3,7-8,11,13,16,28H,4-6H2,(H,22,29)(H2,23,24,25,26,27)/t8?,11-,13-,16-/m1/s1 |
| InChIKey | LSJUVVNDLCSHDE-HJHYIWGASA-N |
| XLogP | 1.74 |
| TPSA | 115.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |