C19H18F4N6O2 — CID 126666816
4-[[(1R,2S)-3,3-difluoro-2-hydroxycyclohexyl]amino]-N-[(2,5-difluorophenyl)methyl]-2H-pyrazolo[3,4-d]pyrimidine-3-carboxamide (PubChem CID 126666816) has the molecular formula C19H18F4N6O2 and a molecular weight of 438.39 g/mol. Its IUPAC name is 4-[[(1R,2S)-3,3-difluoro-2-hydroxycyclohexyl]amino]-N-[(2,5-difluorophenyl)methyl]-2H-pyrazolo[3,4-d]pyrimidine-3-carboxamide.
| Compound Name | 4-[[(1R,2S)-3,3-difluoro-2-hydroxycyclohexyl]amino]-N-[(2,5-difluorophenyl)methyl]-2H-pyrazolo[3,4-d]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 126666816 |
| Molecular Formula | C19H18F4N6O2 |
| Molecular Weight | 438.39 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 4-[[(1R,2S)-3,3-difluoro-2-hydroxycyclohexyl]amino]-N-[(2,5-difluorophenyl)methyl]-2H-pyrazolo[3,4-d]pyrimidine-3-carboxamide |
| SMILES | O=C(NCc1cc(F)ccc1F)c1[nH]nc2ncnc(N[C@@H]3CCCC(F)(F)[C@H]3O)c12 |
| InChI | InChI=1S/C19H18F4N6O2/c20-10-3-4-11(21)9(6-10)7-24-18(31)14-13-16(25-8-26-17(13)29-28-14)27-12-2-1-5-19(22,23)15(12)30/h3-4,6,8,12,15,30H,1-2,5,7H2,(H,24,31)(H2,25,26,27,28,29)/t12-,15+/m1/s1 |
| InChIKey | NIJVECRKGSLCFL-DOMZBBRYSA-N |
| XLogP | 2.52 |
| TPSA | 115.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |