C22H21F3N6O3 — CID 126665397
[(2R,4S)-2-(2,5-difluorophenyl)-4-fluoropyrrolidin-1-yl]-[4-[[(1S,2R,3S,4R,5R)-3,4-dihydroxy-2-bicyclo[3.1.0]hexanyl]amino]-2H-pyrazolo[3,4-d]pyrimidin-3-yl]methanone (PubChem CID 126665397) has the molecular formula C22H21F3N6O3 and a molecular weight of 474.44 g/mol. Its IUPAC name is [(2R,4S)-2-(2,5-difluorophenyl)-4-fluoropyrrolidin-1-yl]-[4-[[(1S,2R,3S,4R,5R)-3,4-dihydroxy-2-bicyclo[3.1.0]hexanyl]amino]-2H-pyrazolo[3,4-d]pyrimidin-3-yl]methanone.
| Compound Name | [(2R,4S)-2-(2,5-difluorophenyl)-4-fluoropyrrolidin-1-yl]-[4-[[(1S,2R,3S,4R,5R)-3,4-dihydroxy-2-bicyclo[3.1.0]hexanyl]amino]-2H-pyrazolo[3,4-d]pyrimidin-3-yl]methanone |
|---|---|
| PubChem CID | 126665397 |
| Molecular Formula | C22H21F3N6O3 |
| Molecular Weight | 474.44 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | [(2R,4S)-2-(2,5-difluorophenyl)-4-fluoropyrrolidin-1-yl]-[4-[[(1S,2R,3S,4R,5R)-3,4-dihydroxy-2-bicyclo[3.1.0]hexanyl]amino]-2H-pyrazolo[3,4-d]pyrimidin-3-yl]methanone |
| SMILES | O=C(c1[nH]nc2ncnc(N[C@H]3[C@H](O)[C@H](O)[C@@H]4C[C@@H]43)c12)N1C[C@@H](F)C[C@@H]1c1cc(F)ccc1F |
| InChI | InChI=1S/C22H21F3N6O3/c23-8-1-2-13(25)12(3-8)14-4-9(24)6-31(14)22(34)17-15-20(26-7-27-21(15)30-29-17)28-16-10-5-11(10)18(32)19(16)33/h1-3,7,9-11,14,16,18-19,32-33H,4-6H2,(H2,26,27,28,29,30)/t9-,10-,11+,14+,16+,18+,19-/m0/s1 |
| InChIKey | AEYKOYYRRPSEGJ-NOOBWMCZSA-N |
| XLogP | 1.71 |
| TPSA | 127.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.44 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |