C23H25F2N5O3 — CID 158062301
[4-[[(1S,2S,4S)-2,4-dihydroxycyclopentyl]amino]-7H-pyrrolo[3,4-d]pyrimidin-5-yl]-[(2R,4S)-4-fluoro-2-(5-fluoro-2-methylphenyl)pyrrolidin-1-yl]methanone (PubChem CID 158062301) has the molecular formula C23H25F2N5O3 and a molecular weight of 457.48 g/mol. Its IUPAC name is [4-[[(1S,2S,4S)-2,4-dihydroxycyclopentyl]amino]-7H-pyrrolo[3,4-d]pyrimidin-5-yl]-[(2R,4S)-4-fluoro-2-(5-fluoro-2-methylphenyl)pyrrolidin-1-yl]methanone.
| Compound Name | [4-[[(1S,2S,4S)-2,4-dihydroxycyclopentyl]amino]-7H-pyrrolo[3,4-d]pyrimidin-5-yl]-[(2R,4S)-4-fluoro-2-(5-fluoro-2-methylphenyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 158062301 |
| Molecular Formula | C23H25F2N5O3 |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | [4-[[(1S,2S,4S)-2,4-dihydroxycyclopentyl]amino]-7H-pyrrolo[3,4-d]pyrimidin-5-yl]-[(2R,4S)-4-fluoro-2-(5-fluoro-2-methylphenyl)pyrrolidin-1-yl]methanone |
| SMILES | Cc1ccc(F)cc1[C@H]1C[C@H](F)CN1C(=O)C1=NCc2ncnc(N[C@H]3C[C@H](O)C[C@@H]3O)c21 |
| InChI | InChI=1S/C23H25F2N5O3/c1-11-2-3-12(24)4-15(11)18-5-13(25)9-30(18)23(33)21-20-17(8-26-21)27-10-28-22(20)29-16-6-14(31)7-19(16)32/h2-4,10,13-14,16,18-19,31-32H,5-9H2,1H3,(H,27,28,29)/t13-,14-,16-,18+,19-/m0/s1 |
| InChIKey | XPJFTKRVRNLIDR-FUUSMOTLSA-N |
| XLogP | 1.83 |
| TPSA | 110.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |