C24H24F3N5O4 — CID 157260522
methyl (1R,3R,4R)-3-[[5-[(2R,4S)-2-(2,5-difluorophenyl)-4-fluoropyrrolidine-1-carbonyl]-7H-pyrrolo[3,4-d]pyrimidin-4-yl]amino]-4-hydroxycyclopentane-1-carboxylate (PubChem CID 157260522) has the molecular formula C24H24F3N5O4 and a molecular weight of 503.48 g/mol. Its IUPAC name is methyl (1R,3R,4R)-3-[[5-[(2R,4S)-2-(2,5-difluorophenyl)-4-fluoropyrrolidine-1-carbonyl]-7H-pyrrolo[3,4-d]pyrimidin-4-yl]amino]-4-hydroxycyclopentane-1-carboxylate.
| Compound Name | methyl (1R,3R,4R)-3-[[5-[(2R,4S)-2-(2,5-difluorophenyl)-4-fluoropyrrolidine-1-carbonyl]-7H-pyrrolo[3,4-d]pyrimidin-4-yl]amino]-4-hydroxycyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 157260522 |
| Molecular Formula | C24H24F3N5O4 |
| Molecular Weight | 503.48 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | methyl (1R,3R,4R)-3-[[5-[(2R,4S)-2-(2,5-difluorophenyl)-4-fluoropyrrolidine-1-carbonyl]-7H-pyrrolo[3,4-d]pyrimidin-4-yl]amino]-4-hydroxycyclopentane-1-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@@H](O)[C@H](Nc2ncnc3c2C(C(=O)N2C[C@@H](F)C[C@@H]2c2cc(F)ccc2F)=NC3)C1 |
| InChI | InChI=1S/C24H24F3N5O4/c1-36-24(35)11-4-16(19(33)5-11)31-22-20-17(29-10-30-22)8-28-21(20)23(34)32-9-13(26)7-18(32)14-6-12(25)2-3-15(14)27/h2-3,6,10-11,13,16,18-19,33H,4-5,7-9H2,1H3,(H,29,30,31)/t11-,13+,16-,18-,19-/m1/s1 |
| InChIKey | ZYMSFXQOWBMZPR-AKYPLOPGSA-N |
| XLogP | 2.09 |
| TPSA | 117.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.48 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |