C20H25ClF2N4O3S — CID 160907457
methyl 5-chloro-4-[6-[(4,4-difluorocyclohexyl)amino]-2-(4-methyl-1,3-thiazol-2-yl)pyrimidin-4-yl]oxypentanoate (PubChem CID 160907457) has the molecular formula C20H25ClF2N4O3S and a molecular weight of 474.96 g/mol. Its IUPAC name is methyl 5-chloro-4-[6-[(4,4-difluorocyclohexyl)amino]-2-(4-methyl-1,3-thiazol-2-yl)pyrimidin-4-yl]oxypentanoate.
| Compound Name | methyl 5-chloro-4-[6-[(4,4-difluorocyclohexyl)amino]-2-(4-methyl-1,3-thiazol-2-yl)pyrimidin-4-yl]oxypentanoate |
|---|---|
| PubChem CID | 160907457 |
| Molecular Formula | C20H25ClF2N4O3S |
| Molecular Weight | 474.96 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | methyl 5-chloro-4-[6-[(4,4-difluorocyclohexyl)amino]-2-(4-methyl-1,3-thiazol-2-yl)pyrimidin-4-yl]oxypentanoate |
| SMILES | COC(=O)CCC(CCl)Oc1cc(NC2CCC(F)(F)CC2)nc(-c2nc(C)cs2)n1 |
| InChI | InChI=1S/C20H25ClF2N4O3S/c1-12-11-31-19(24-12)18-26-15(25-13-5-7-20(22,23)8-6-13)9-16(27-18)30-14(10-21)3-4-17(28)29-2/h9,11,13-14H,3-8,10H2,1-2H3,(H,25,26,27) |
| InChIKey | SQIGWBHVEGHLRX-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.96 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|