2-(4-bromo-2-cyclohexylphenoxy)acetic acid

C28H34Br2O6 — CID 160908207

IUPAC2-(4-bromo-2-cyclohexylphenoxy)acetic acid
SMILESO=C(O)COc1ccc(Br)cc1C1CCCCC1.O=C(O)COc1ccc(Br)cc1C1CCCCC1
InChIInChI=1S/2C14H17BrO3/c2*15-11-6-7-13(18-9-14(16)17)12(8-11)10-4-2-1-3-5-10/h2*6-8,10H,1-5,9H2,(H,16,17)
InChIKeySQKPROIJNOWKJC-UHFFFAOYSA-N
MW626.38 g/mol
LogP7.92
Rot. Bonds8

About 2-(4-bromo-2-cyclohexylphenoxy)acetic acid

2-(4-bromo-2-cyclohexylphenoxy)acetic acid (PubChem CID 160908207) has the molecular formula C28H34Br2O6 and a molecular weight of 626.38 g/mol. Its IUPAC name is 2-(4-bromo-2-cyclohexylphenoxy)acetic acid.

Molecular Properties

Compound Name2-(4-bromo-2-cyclohexylphenoxy)acetic acid
PubChem CID160908207
Molecular FormulaC28H34Br2O6
Molecular Weight626.38 g/mol
Exact Mass624.07
IUPAC Name2-(4-bromo-2-cyclohexylphenoxy)acetic acid
SMILESO=C(O)COc1ccc(Br)cc1C1CCCCC1.O=C(O)COc1ccc(Br)cc1C1CCCCC1
InChIInChI=1S/2C14H17BrO3/c2*15-11-6-7-13(18-9-14(16)17)12(8-11)10-4-2-1-3-5-10/h2*6-8,10H,1-5,9H2,(H,16,17)
InChIKeySQKPROIJNOWKJC-UHFFFAOYSA-N
XLogP7.92
TPSA93.06 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms36
Complexity

Lipinski Rule of Five

2 violations

RuleValue
MW ≤ 500626.38
LogP ≤ 57.92
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-(4-bromo-2-cyclohexylphenoxy)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-bromo-2-cyclohexylphenoxy)acetic acid?
The IUPAC name of 2-(4-bromo-2-cyclohexylphenoxy)acetic acid (CID 160908207) is 2-(4-bromo-2-cyclohexylphenoxy)acetic acid.
What is the SMILES notation for 2-(4-bromo-2-cyclohexylphenoxy)acetic acid?
The canonical SMILES for 2-(4-bromo-2-cyclohexylphenoxy)acetic acid is O=C(O)COc1ccc(Br)cc1C1CCCCC1.O=C(O)COc1ccc(Br)cc1C1CCCCC1.
What is the InChIKey of 2-(4-bromo-2-cyclohexylphenoxy)acetic acid?
The InChIKey is SQKPROIJNOWKJC-UHFFFAOYSA-N. The full InChI is InChI=1S/2C14H17BrO3/c2*15-11-6-7-13(18-9-14(16)17)12(8-11)10-4-2-1-3-5-10/h2*6-8,10H,1-5,9H2,(H,16,17).
What are the key properties of 2-(4-bromo-2-cyclohexylphenoxy)acetic acid?
2-(4-bromo-2-cyclohexylphenoxy)acetic acid has a molecular weight of 626.38 g/mol, XLogP of 7.92, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromo-2-cyclohexylphenoxy)acetic acid is sourced from PubChem (CID 160908207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).