C18H33N9 — CID 160908839
bis(1,4-diethyltriazole);1,5-diethyltriazole (PubChem CID 160908839) has the molecular formula C18H33N9 and a molecular weight of 375.53 g/mol. Its IUPAC name is bis(1,4-diethyltriazole);1,5-diethyltriazole.
| Compound Name | bis(1,4-diethyltriazole);1,5-diethyltriazole |
|---|---|
| PubChem CID | 160908839 |
| Molecular Formula | C18H33N9 |
| Molecular Weight | 375.53 g/mol |
| Exact Mass | 375.29 |
| IUPAC Name | bis(1,4-diethyltriazole);1,5-diethyltriazole |
| SMILES | CCc1cn(CC)nn1.CCc1cn(CC)nn1.CCc1cnnn1CC |
| InChI | InChI=1S/3C6H11N3/c2*1-3-6-5-9(4-2)8-7-6;1-3-6-5-7-8-9(6)4-2/h3*5H,3-4H2,1-2H3 |
| InChIKey | SQMSMWFNKXUEOE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 92.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.53 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |