C36H68N2O9Si2 — CID 160910646
tert-butyl (3E)-3-(2-acetyloxyethylidene)-4-[tert-butyl(dimethyl)silyl]oxypiperidine-1-carboxylate;tert-butyl 4-[tert-butyl(dimethyl)silyl]oxy-3-oxopiperidine-1-carboxylate (PubChem CID 160910646) has the molecular formula C36H68N2O9Si2 and a molecular weight of 729.12 g/mol. Its IUPAC name is tert-butyl (3E)-3-(2-acetyloxyethylidene)-4-[tert-butyl(dimethyl)silyl]oxypiperidine-1-carboxylate;tert-butyl 4-[tert-butyl(dimethyl)silyl]oxy-3-oxopiperidine-1-carboxylate.
| Compound Name | tert-butyl (3E)-3-(2-acetyloxyethylidene)-4-[tert-butyl(dimethyl)silyl]oxypiperidine-1-carboxylate;tert-butyl 4-[tert-butyl(dimethyl)silyl]oxy-3-oxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 160910646 |
| Molecular Formula | C36H68N2O9Si2 |
| Molecular Weight | 729.12 g/mol |
| Exact Mass | 728.45 |
| IUPAC Name | tert-butyl (3E)-3-(2-acetyloxyethylidene)-4-[tert-butyl(dimethyl)silyl]oxypiperidine-1-carboxylate;tert-butyl 4-[tert-butyl(dimethyl)silyl]oxy-3-oxopiperidine-1-carboxylate |
| SMILES | CC(=O)OC/C=C1\CN(C(=O)OC(C)(C)C)CCC1O[Si](C)(C)C(C)(C)C.CC(C)(C)OC(=O)N1CCC(O[Si](C)(C)C(C)(C)C)C(=O)C1 |
| InChI | InChI=1S/C20H37NO5Si.C16H31NO4Si/c1-15(22)24-13-11-16-14-21(18(23)25-19(2,3)4)12-10-17(16)26-27(8,9)20(5,6)7;1-15(2,3)20-14(19)17-10-9-13(12(18)11-17)21-22(7,8)16(4,5)6/h11,17H,10,12-14H2,1-9H3;13H,9-11H2,1-8H3/b16-11+; |
| InChIKey | SQSOJILFVDGWBW-YFMOEUEHSA-N |
| XLogP | 8.09 |
| TPSA | 120.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.12 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|