C28H45N3O3Si — CID 160911542
tert-butyl 4-[5-methyl-1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridine-4-carbonyl]piperidine-1-carboxylate (PubChem CID 160911542) has the molecular formula C28H45N3O3Si and a molecular weight of 499.77 g/mol. Its IUPAC name is tert-butyl 4-[5-methyl-1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridine-4-carbonyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-methyl-1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridine-4-carbonyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 160911542 |
| Molecular Formula | C28H45N3O3Si |
| Molecular Weight | 499.77 g/mol |
| Exact Mass | 499.32 |
| IUPAC Name | tert-butyl 4-[5-methyl-1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridine-4-carbonyl]piperidine-1-carboxylate |
| SMILES | Cc1cnc2c(ccn2[Si](C(C)C)(C(C)C)C(C)C)c1C(=O)C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C28H45N3O3Si/c1-18(2)35(19(3)4,20(5)6)31-16-13-23-24(21(7)17-29-26(23)31)25(32)22-11-14-30(15-12-22)27(33)34-28(8,9)10/h13,16-20,22H,11-12,14-15H2,1-10H3 |
| InChIKey | MLZLLHYBIHKJHX-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.77 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|