C26H42BrN3O2Si — CID 58512046
tert-butyl 4-[6-bromo-1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridin-3-yl]piperidine-1-carboxylate (PubChem CID 58512046) has the molecular formula C26H42BrN3O2Si and a molecular weight of 536.63 g/mol. Its IUPAC name is tert-butyl 4-[6-bromo-1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridin-3-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[6-bromo-1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridin-3-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58512046 |
| Molecular Formula | C26H42BrN3O2Si |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | tert-butyl 4-[6-bromo-1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridin-3-yl]piperidine-1-carboxylate |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)n1cc(C2CCN(C(=O)OC(C)(C)C)CC2)c2ccc(Br)nc21 |
| InChI | InChI=1S/C26H42BrN3O2Si/c1-17(2)33(18(3)4,19(5)6)30-16-22(21-10-11-23(27)28-24(21)30)20-12-14-29(15-13-20)25(31)32-26(7,8)9/h10-11,16-20H,12-15H2,1-9H3 |
| InChIKey | NOGLECXVDBLZKI-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|