C20H26N4O6 — CID 160914982
(2'R,4'S,4'aS)-4'-methyl-8'-nitro-2'-propylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-2,4,6-trione;methane (PubChem CID 160914982) has the molecular formula C20H26N4O6 and a molecular weight of 418.45 g/mol. Its IUPAC name is (2'R,4'S,4'aS)-4'-methyl-8'-nitro-2'-propylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-2,4,6-trione;methane.
| Compound Name | (2'R,4'S,4'aS)-4'-methyl-8'-nitro-2'-propylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-2,4,6-trione;methane |
|---|---|
| PubChem CID | 160914982 |
| Molecular Formula | C20H26N4O6 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | (2'R,4'S,4'aS)-4'-methyl-8'-nitro-2'-propylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-2,4,6-trione;methane |
| SMILES | C.CCC[C@@H]1CN2c3ccc([N+](=O)[O-])cc3CC3(C(=O)NC(=O)NC3=O)[C@H]2[C@H](C)O1 |
| InChI | InChI=1S/C19H22N4O6.CH4/c1-3-4-13-9-22-14-6-5-12(23(27)28)7-11(14)8-19(15(22)10(2)29-13)16(24)20-18(26)21-17(19)25;/h5-7,10,13,15H,3-4,8-9H2,1-2H3,(H2,20,21,24,25,26);1H4/t10-,13+,15+;/m0./s1 |
| InChIKey | SRGZNDQUVCFAJH-CLEUYQRNSA-N |
| XLogP | 1.90 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|