C17H15F3N4O6 — CID 58847203
(2'S,4'S,4'aS)-4'-methyl-8'-nitro-2'-(trifluoromethyl)spiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-2,4,6-trione (PubChem CID 58847203) has the molecular formula C17H15F3N4O6 and a molecular weight of 428.32 g/mol. Its IUPAC name is (2'S,4'S,4'aS)-4'-methyl-8'-nitro-2'-(trifluoromethyl)spiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-2,4,6-trione.
| Compound Name | (2'S,4'S,4'aS)-4'-methyl-8'-nitro-2'-(trifluoromethyl)spiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 58847203 |
| Molecular Formula | C17H15F3N4O6 |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | (2'S,4'S,4'aS)-4'-methyl-8'-nitro-2'-(trifluoromethyl)spiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-2,4,6-trione |
| SMILES | C[C@@H]1O[C@H](C(F)(F)F)CN2c3ccc([N+](=O)[O-])cc3CC3(C(=O)NC(=O)NC3=O)[C@@H]12 |
| InChI | InChI=1S/C17H15F3N4O6/c1-7-12-16(13(25)21-15(27)22-14(16)26)5-8-4-9(24(28)29)2-3-10(8)23(12)6-11(30-7)17(18,19)20/h2-4,7,11-12H,5-6H2,1H3,(H2,21,22,25,26,27)/t7-,11-,12+/m0/s1 |
| InChIKey | CFQGVYHLULDUCM-CQFDHEJISA-N |
| XLogP | 1.03 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|