C18H34O13 — CID 160915512
(2R,3S,4S,5S,6S)-2-(hydroxymethyl)-6-prop-2-enoxyoxane-3,4,5-triol;(2S,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;prop-2-en-1-ol (PubChem CID 160915512) has the molecular formula C18H34O13 and a molecular weight of 458.46 g/mol. Its IUPAC name is (2R,3S,4S,5S,6S)-2-(hydroxymethyl)-6-prop-2-enoxyoxane-3,4,5-triol;(2S,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;prop-2-en-1-ol.
| Compound Name | (2R,3S,4S,5S,6S)-2-(hydroxymethyl)-6-prop-2-enoxyoxane-3,4,5-triol;(2S,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;prop-2-en-1-ol |
|---|---|
| PubChem CID | 160915512 |
| Molecular Formula | C18H34O13 |
| Molecular Weight | 458.46 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | (2R,3S,4S,5S,6S)-2-(hydroxymethyl)-6-prop-2-enoxyoxane-3,4,5-triol;(2S,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;prop-2-en-1-ol |
| SMILES | C=CCO.C=CCO[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O.O=C[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C9H16O6.C6H12O6.C3H6O/c1-2-3-14-9-8(13)7(12)6(11)5(4-10)15-9;7-1-3(9)5(11)6(12)4(10)2-8;1-2-3-4/h2,5-13H,1,3-4H2;1,3-6,8-12H,2H2;2,4H,1,3H2/t5-,6-,7+,8+,9+;3-,4-,5-,6-;/m11./s1 |
| InChIKey | SRISOVMKFVVQIB-GAQJGMNESA-N |
| XLogP | -5.23 |
| TPSA | 237.83 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.46 |
| LogP ≤ 5 | -5.23 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|