About cyclohexyl(trimethoxy)silane;tributoxy(ethenyl)silane
cyclohexyl(trimethoxy)silane;tributoxy(ethenyl)silane (PubChem CID 160917437) has the molecular formula C23H50O6Si2
and a molecular weight of 478.82 g/mol. Its IUPAC name is cyclohexyl(trimethoxy)silane;tributoxy(ethenyl)silane.
Molecular Properties
| Compound Name | cyclohexyl(trimethoxy)silane;tributoxy(ethenyl)silane |
| PubChem CID | 160917437 |
| Molecular Formula | C23H50O6Si2 |
| Molecular Weight | 478.82 g/mol |
| Exact Mass | 478.31 |
| IUPAC Name | cyclohexyl(trimethoxy)silane;tributoxy(ethenyl)silane |
| SMILES | C=C[Si](OCCCC)(OCCCC)OCCCC.CO[Si](OC)(OC)C1CCCCC1 |
| InChI | InChI=1S/C14H30O3Si.C9H20O3Si/c1-5-9-12-15-18(8-4,16-13-10-6-2)17-14-11-7-3;1-10-13(11-2,12-3)9-7-5-4-6-8-9/h8H,4-7,9-14H2,1-3H3;9H,4-8H2,1-3H3 |
| InChIKey | SROXWUBKJACVKZ-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 478.82 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cyclohexyl(trimethoxy)silane;tributoxy(ethenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl(trimethoxy)silane;tributoxy(ethenyl)silane?
The IUPAC name of cyclohexyl(trimethoxy)silane;tributoxy(ethenyl)silane (CID 160917437) is cyclohexyl(trimethoxy)silane;tributoxy(ethenyl)silane.
What is the SMILES notation for cyclohexyl(trimethoxy)silane;tributoxy(ethenyl)silane?
The canonical SMILES for cyclohexyl(trimethoxy)silane;tributoxy(ethenyl)silane is C=C[Si](OCCCC)(OCCCC)OCCCC.CO[Si](OC)(OC)C1CCCCC1.
What is the InChIKey of cyclohexyl(trimethoxy)silane;tributoxy(ethenyl)silane?
The InChIKey is SROXWUBKJACVKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30O3Si.C9H20O3Si/c1-5-9-12-15-18(8-4,16-13-10-6-2)17-14-11-7-3;1-10-13(11-2,12-3)9-7-5-4-6-8-9/h8H,4-7,9-14H2,1-3H3;9H,4-8H2,1-3H3.
What are the key properties of cyclohexyl(trimethoxy)silane;tributoxy(ethenyl)silane?
cyclohexyl(trimethoxy)silane;tributoxy(ethenyl)silane has a molecular weight of 478.82 g/mol, XLogP of 6.30, 17 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl(trimethoxy)silane;tributoxy(ethenyl)silane is sourced from PubChem (CID 160917437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).