C23H51NO9Si2 — CID 172850782
ethenyl-tris(2-methoxyethoxy)silane;N-(3-trimethoxysilylpropyl)cyclohexanamine (PubChem CID 172850782) has the molecular formula C23H51NO9Si2 and a molecular weight of 541.83 g/mol. Its IUPAC name is ethenyl-tris(2-methoxyethoxy)silane;N-(3-trimethoxysilylpropyl)cyclohexanamine.
| Compound Name | ethenyl-tris(2-methoxyethoxy)silane;N-(3-trimethoxysilylpropyl)cyclohexanamine |
|---|---|
| PubChem CID | 172850782 |
| Molecular Formula | C23H51NO9Si2 |
| Molecular Weight | 541.83 g/mol |
| Exact Mass | 541.31 |
| IUPAC Name | ethenyl-tris(2-methoxyethoxy)silane;N-(3-trimethoxysilylpropyl)cyclohexanamine |
| SMILES | C=C[Si](OCCOC)(OCCOC)OCCOC.CO[Si](CCCNC1CCCCC1)(OC)OC |
| InChI | InChI=1S/C12H27NO3Si.C11H24O6Si/c1-14-17(15-2,16-3)11-7-10-13-12-8-5-4-6-9-12;1-5-18(15-9-6-12-2,16-10-7-13-3)17-11-8-14-4/h12-13H,4-11H2,1-3H3;5H,1,6-11H2,2-4H3 |
| InChIKey | YARJGQFFTSSHHT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 95.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.83 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|