C17H39N3O3Si — CID 23596606
4-N-[2-(propan-2-ylamino)ethyl]-1-N-(3-trimethoxysilylpropyl)cyclohexane-1,4-diamine (PubChem CID 23596606) has the molecular formula C17H39N3O3Si and a molecular weight of 361.60 g/mol. Its IUPAC name is 4-N-[2-(propan-2-ylamino)ethyl]-1-N-(3-trimethoxysilylpropyl)cyclohexane-1,4-diamine.
| Compound Name | 4-N-[2-(propan-2-ylamino)ethyl]-1-N-(3-trimethoxysilylpropyl)cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 23596606 |
| Molecular Formula | C17H39N3O3Si |
| Molecular Weight | 361.60 g/mol |
| Exact Mass | 361.28 |
| IUPAC Name | 4-N-[2-(propan-2-ylamino)ethyl]-1-N-(3-trimethoxysilylpropyl)cyclohexane-1,4-diamine |
| SMILES | CO[Si](CCCNC1CCC(NCCNC(C)C)CC1)(OC)OC |
| InChI | InChI=1S/C17H39N3O3Si/c1-15(2)18-12-13-20-17-9-7-16(8-10-17)19-11-6-14-24(21-3,22-4)23-5/h15-20H,6-14H2,1-5H3 |
| InChIKey | MDAIRRKUSVRZCP-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 63.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.60 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|