C13H28N2 — CID 66337356
N'-cyclopropyl-3-methyl-N-propan-2-ylhexane-1,6-diamine (PubChem CID 66337356) has the molecular formula C13H28N2 and a molecular weight of 212.38 g/mol. Its IUPAC name is N'-cyclopropyl-3-methyl-N-propan-2-ylhexane-1,6-diamine.
| Compound Name | N'-cyclopropyl-3-methyl-N-propan-2-ylhexane-1,6-diamine |
|---|---|
| PubChem CID | 66337356 |
| Molecular Formula | C13H28N2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.23 |
| IUPAC Name | N'-cyclopropyl-3-methyl-N-propan-2-ylhexane-1,6-diamine |
| SMILES | CC(CCCNC1CC1)CCNC(C)C |
| InChI | InChI=1S/C13H28N2/c1-11(2)14-10-8-12(3)5-4-9-15-13-6-7-13/h11-15H,4-10H2,1-3H3 |
| InChIKey | RJJWEKOALIVSFF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|