C12H30N2 — CID 142089366
N-cyclohexyl-N'-propan-2-ylpropane-1,3-diamine;molecular hydrogen (PubChem CID 142089366) has the molecular formula C12H30N2 and a molecular weight of 202.39 g/mol. Its IUPAC name is N-cyclohexyl-N'-propan-2-ylpropane-1,3-diamine;molecular hydrogen.
| Compound Name | N-cyclohexyl-N'-propan-2-ylpropane-1,3-diamine;molecular hydrogen |
|---|---|
| PubChem CID | 142089366 |
| Molecular Formula | C12H30N2 |
| Molecular Weight | 202.39 g/mol |
| Exact Mass | 202.24 |
| IUPAC Name | N-cyclohexyl-N'-propan-2-ylpropane-1,3-diamine;molecular hydrogen |
| SMILES | CC(C)NCCCNC1CCCCC1.[H][H].[H][H] |
| InChI | InChI=1S/C12H26N2.2H2/c1-11(2)13-9-6-10-14-12-7-4-3-5-8-12;;/h11-14H,3-10H2,1-2H3;2*1H |
| InChIKey | RSBJQLUHUIWMAQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|