C38H37Cl2N5O7 — CID 160921286
(2R)-2-amino-2-phenylethanol;2-N,6-N-bis[(1R)-2-hydroxy-1-phenylethyl]pyridine-2,6-dicarboxamide;pyridine-2,6-dicarbonyl chloride (PubChem CID 160921286) has the molecular formula C38H37Cl2N5O7 and a molecular weight of 746.65 g/mol. Its IUPAC name is (2R)-2-amino-2-phenylethanol;2-N,6-N-bis[(1R)-2-hydroxy-1-phenylethyl]pyridine-2,6-dicarboxamide;pyridine-2,6-dicarbonyl chloride.
| Compound Name | (2R)-2-amino-2-phenylethanol;2-N,6-N-bis[(1R)-2-hydroxy-1-phenylethyl]pyridine-2,6-dicarboxamide;pyridine-2,6-dicarbonyl chloride |
|---|---|
| PubChem CID | 160921286 |
| Molecular Formula | C38H37Cl2N5O7 |
| Molecular Weight | 746.65 g/mol |
| Exact Mass | 745.21 |
| IUPAC Name | (2R)-2-amino-2-phenylethanol;2-N,6-N-bis[(1R)-2-hydroxy-1-phenylethyl]pyridine-2,6-dicarboxamide;pyridine-2,6-dicarbonyl chloride |
| SMILES | N[C@@H](CO)c1ccccc1.O=C(Cl)c1cccc(C(=O)Cl)n1.O=C(N[C@@H](CO)c1ccccc1)c1cccc(C(=O)N[C@@H](CO)c2ccccc2)n1 |
| InChI | InChI=1S/C23H23N3O4.C8H11NO.C7H3Cl2NO2/c27-14-20(16-8-3-1-4-9-16)25-22(29)18-12-7-13-19(24-18)23(30)26-21(15-28)17-10-5-2-6-11-17;9-8(6-10)7-4-2-1-3-5-7;8-6(11)4-2-1-3-5(10-4)7(9)12/h1-13,20-21,27-28H,14-15H2,(H,25,29)(H,26,30);1-5,8,10H,6,9H2;1-3H/t20-,21-;8-;/m00./s1 |
| InChIKey | SSBIKHXEATVEKA-UNPXPFRISA-N |
| XLogP | 4.53 |
| TPSA | 204.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.65 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|