C7H6F3N3O3 — CID 160922630
pyrimidine-4-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 160922630) has the molecular formula C7H6F3N3O3 and a molecular weight of 237.14 g/mol. Its IUPAC name is pyrimidine-4-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | pyrimidine-4-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 160922630 |
| Molecular Formula | C7H6F3N3O3 |
| Molecular Weight | 237.14 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | pyrimidine-4-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | NC(=O)c1ccncn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C5H5N3O.C2HF3O2/c6-5(9)4-1-2-7-3-8-4;3-2(4,5)1(6)7/h1-3H,(H2,6,9);(H,6,7) |
| InChIKey | SSFPLTJTUJJJML-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 106.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.14 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |