C37H44F6N8O — CID 160922648
1,1-diphenyl-N-[6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]-2-pyridinyl]methanimine;ethanol;6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyridin-2-amine (PubChem CID 160922648) has the molecular formula C37H44F6N8O and a molecular weight of 730.80 g/mol. Its IUPAC name is 1,1-diphenyl-N-[6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]-2-pyridinyl]methanimine;ethanol;6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyridin-2-amine.
| Compound Name | 1,1-diphenyl-N-[6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]-2-pyridinyl]methanimine;ethanol;6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 160922648 |
| Molecular Formula | C37H44F6N8O |
| Molecular Weight | 730.80 g/mol |
| Exact Mass | 730.35 |
| IUPAC Name | 1,1-diphenyl-N-[6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]-2-pyridinyl]methanimine;ethanol;6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyridin-2-amine |
| SMILES | CCO.FC(F)(F)CN1CCN(c2cccc(N=C(c3ccccc3)c3ccccc3)n2)CC1.Nc1cccc(N2CCN(CC(F)(F)F)CC2)n1 |
| InChI | InChI=1S/C24H23F3N4.C11H15F3N4.C2H6O/c25-24(26,27)18-30-14-16-31(17-15-30)22-13-7-12-21(28-22)29-23(19-8-3-1-4-9-19)20-10-5-2-6-11-20;12-11(13,14)8-17-4-6-18(7-5-17)10-3-1-2-9(15)16-10;1-2-3/h1-13H,14-18H2;1-3H,4-8H2,(H2,15,16);3H,2H2,1H3 |
| InChIKey | SSFQYZTVURILTQ-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.80 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|