C33H42N2O6 — CID 160926484
6-decoxy-7-ethoxy-2-ethyl-4-oxo-1H-quinoline-3-carboxylic acid;1H-quinolin-4-one (PubChem CID 160926484) has the molecular formula C33H42N2O6 and a molecular weight of 562.71 g/mol. Its IUPAC name is 6-decoxy-7-ethoxy-2-ethyl-4-oxo-1H-quinoline-3-carboxylic acid;1H-quinolin-4-one.
| Compound Name | 6-decoxy-7-ethoxy-2-ethyl-4-oxo-1H-quinoline-3-carboxylic acid;1H-quinolin-4-one |
|---|---|
| PubChem CID | 160926484 |
| Molecular Formula | C33H42N2O6 |
| Molecular Weight | 562.71 g/mol |
| Exact Mass | 562.30 |
| IUPAC Name | 6-decoxy-7-ethoxy-2-ethyl-4-oxo-1H-quinoline-3-carboxylic acid;1H-quinolin-4-one |
| SMILES | CCCCCCCCCCOc1cc2c(=O)c(C(=O)O)c(CC)[nH]c2cc1OCC.O=c1cc[nH]c2ccccc12 |
| InChI | InChI=1S/C24H35NO5.C9H7NO/c1-4-7-8-9-10-11-12-13-14-30-20-15-17-19(16-21(20)29-6-3)25-18(5-2)22(23(17)26)24(27)28;11-9-5-6-10-8-4-2-1-3-7(8)9/h15-16H,4-14H2,1-3H3,(H,25,26)(H,27,28);1-6H,(H,10,11) |
| InChIKey | SSSBJGBNXZVWMB-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 121.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.71 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|