C24H35NO6 — CID 123144024
ethyl 6-decoxy-7-ethoxy-4-hydroxy-2-oxo-1H-quinoline-3-carboxylate (PubChem CID 123144024) has the molecular formula C24H35NO6 and a molecular weight of 433.55 g/mol. Its IUPAC name is ethyl 6-decoxy-7-ethoxy-4-hydroxy-2-oxo-1H-quinoline-3-carboxylate.
| Compound Name | ethyl 6-decoxy-7-ethoxy-4-hydroxy-2-oxo-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 123144024 |
| Molecular Formula | C24H35NO6 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | ethyl 6-decoxy-7-ethoxy-4-hydroxy-2-oxo-1H-quinoline-3-carboxylate |
| SMILES | CCCCCCCCCCOc1cc2c(O)c(C(=O)OCC)c(=O)[nH]c2cc1OCC |
| InChI | InChI=1S/C24H35NO6/c1-4-7-8-9-10-11-12-13-14-31-19-15-17-18(16-20(19)29-5-2)25-23(27)21(22(17)26)24(28)30-6-3/h15-16H,4-14H2,1-3H3,(H2,25,26,27) |
| InChIKey | GVDAKTOCHIFJTF-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 97.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|