C21H25NO2 — CID 160928097
4,4-dimethyl-6-oxo-N,7-diphenylheptanamide (PubChem CID 160928097) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is 4,4-dimethyl-6-oxo-N,7-diphenylheptanamide.
| Compound Name | 4,4-dimethyl-6-oxo-N,7-diphenylheptanamide |
|---|---|
| PubChem CID | 160928097 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 4,4-dimethyl-6-oxo-N,7-diphenylheptanamide |
| SMILES | CC(C)(CCC(=O)Nc1ccccc1)CC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C21H25NO2/c1-21(2,16-19(23)15-17-9-5-3-6-10-17)14-13-20(24)22-18-11-7-4-8-12-18/h3-12H,13-16H2,1-2H3,(H,22,24) |
| InChIKey | JJOZNTIPXMFZJE-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |