C28H41NO3 — CID 160928471
ethane;[1-(4-oxopentyl)piperidin-4-yl] 2-(2-phenylphenyl)acetate (PubChem CID 160928471) has the molecular formula C28H41NO3 and a molecular weight of 439.64 g/mol. Its IUPAC name is ethane;[1-(4-oxopentyl)piperidin-4-yl] 2-(2-phenylphenyl)acetate.
| Compound Name | ethane;[1-(4-oxopentyl)piperidin-4-yl] 2-(2-phenylphenyl)acetate |
|---|---|
| PubChem CID | 160928471 |
| Molecular Formula | C28H41NO3 |
| Molecular Weight | 439.64 g/mol |
| Exact Mass | 439.31 |
| IUPAC Name | ethane;[1-(4-oxopentyl)piperidin-4-yl] 2-(2-phenylphenyl)acetate |
| SMILES | CC.CC.CC(=O)CCCN1CCC(OC(=O)Cc2ccccc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C24H29NO3.2C2H6/c1-19(26)8-7-15-25-16-13-22(14-17-25)28-24(27)18-21-11-5-6-12-23(21)20-9-3-2-4-10-20;2*1-2/h2-6,9-12,22H,7-8,13-18H2,1H3;2*1-2H3 |
| InChIKey | SSYGORCGQBLEPM-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.64 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |