C24H23ClN4O3 — CID 160932599
1-chloropropan-2-one;3-(isocyanomethyl)benzamide;2-[3-(isocyanomethyl)phenyl]-4-methyl-1,3-oxazole (PubChem CID 160932599) has the molecular formula C24H23ClN4O3 and a molecular weight of 450.93 g/mol. Its IUPAC name is 1-chloropropan-2-one;3-(isocyanomethyl)benzamide;2-[3-(isocyanomethyl)phenyl]-4-methyl-1,3-oxazole.
| Compound Name | 1-chloropropan-2-one;3-(isocyanomethyl)benzamide;2-[3-(isocyanomethyl)phenyl]-4-methyl-1,3-oxazole |
|---|---|
| PubChem CID | 160932599 |
| Molecular Formula | C24H23ClN4O3 |
| Molecular Weight | 450.93 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 1-chloropropan-2-one;3-(isocyanomethyl)benzamide;2-[3-(isocyanomethyl)phenyl]-4-methyl-1,3-oxazole |
| SMILES | CC(=O)CCl.[C-]#[N+]Cc1cccc(-c2nc(C)co2)c1.[C-]#[N+]Cc1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C12H10N2O.C9H8N2O.C3H5ClO/c1-9-8-15-12(14-9)11-5-3-4-10(6-11)7-13-2;1-11-6-7-3-2-4-8(5-7)9(10)12;1-3(5)2-4/h3-6,8H,7H2,1H3;2-5H,6H2,(H2,10,12);2H2,1H3 |
| InChIKey | STLOHQFNBWXKLU-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.93 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|