C32H34ClN3O6 — CID 160943592
1-(4-chloro-3-methylphenyl)-3-[4-[[5-(6-methoxyhexoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-10-yl]oxy]phenyl]urea (PubChem CID 160943592) has the molecular formula C32H34ClN3O6 and a molecular weight of 592.09 g/mol. Its IUPAC name is 1-(4-chloro-3-methylphenyl)-3-[4-[[5-(6-methoxyhexoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-10-yl]oxy]phenyl]urea.
| Compound Name | 1-(4-chloro-3-methylphenyl)-3-[4-[[5-(6-methoxyhexoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-10-yl]oxy]phenyl]urea |
|---|---|
| PubChem CID | 160943592 |
| Molecular Formula | C32H34ClN3O6 |
| Molecular Weight | 592.09 g/mol |
| Exact Mass | 591.21 |
| IUPAC Name | 1-(4-chloro-3-methylphenyl)-3-[4-[[5-(6-methoxyhexoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-10-yl]oxy]phenyl]urea |
| SMILES | COCCCCCCOc1cc2nccc(Oc3ccc(NC(=O)Nc4ccc(Cl)c(C)c4)cc3)c2c2c1OCCO2 |
| InChI | InChI=1S/C32H34ClN3O6/c1-21-19-23(9-12-25(21)33)36-32(37)35-22-7-10-24(11-8-22)42-27-13-14-34-26-20-28(39-16-6-4-3-5-15-38-2)30-31(29(26)27)41-18-17-40-30/h7-14,19-20H,3-6,15-18H2,1-2H3,(H2,35,36,37) |
| InChIKey | RZYWHCQGPQVDDB-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 100.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.09 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|