C30H27FN4O5 — CID 146438707
1-[4-[[5-(3-cyanopropoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-10-yl]oxy]phenyl]-3-[(1S)-1-(4-fluorophenyl)ethyl]urea (PubChem CID 146438707) has the molecular formula C30H27FN4O5 and a molecular weight of 542.57 g/mol. Its IUPAC name is 1-[4-[[5-(3-cyanopropoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-10-yl]oxy]phenyl]-3-[(1S)-1-(4-fluorophenyl)ethyl]urea.
| Compound Name | 1-[4-[[5-(3-cyanopropoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-10-yl]oxy]phenyl]-3-[(1S)-1-(4-fluorophenyl)ethyl]urea |
|---|---|
| PubChem CID | 146438707 |
| Molecular Formula | C30H27FN4O5 |
| Molecular Weight | 542.57 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | 1-[4-[[5-(3-cyanopropoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-10-yl]oxy]phenyl]-3-[(1S)-1-(4-fluorophenyl)ethyl]urea |
| SMILES | C[C@H](NC(=O)Nc1ccc(Oc2ccnc3cc(OCCCC#N)c4c(c23)OCCO4)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C30H27FN4O5/c1-19(20-4-6-21(31)7-5-20)34-30(36)35-22-8-10-23(11-9-22)40-25-12-14-33-24-18-26(37-15-3-2-13-32)28-29(27(24)25)39-17-16-38-28/h4-12,14,18-19H,2-3,15-17H2,1H3,(H2,34,35,36)/t19-/m0/s1 |
| InChIKey | FVIUQHLASQYZRT-IBGZPJMESA-N |
| XLogP | 6.50 |
| TPSA | 114.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.57 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|