C36H65N2O12P — CID 160945142
tert-butyl 2-diethoxyphosphorylacetate;tert-butyl 4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethylidene]piperidine-1-carboxylate;tert-butyl 4-oxopiperidine-1-carboxylate (PubChem CID 160945142) has the molecular formula C36H65N2O12P and a molecular weight of 748.89 g/mol. Its IUPAC name is tert-butyl 2-diethoxyphosphorylacetate;tert-butyl 4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethylidene]piperidine-1-carboxylate;tert-butyl 4-oxopiperidine-1-carboxylate.
| Compound Name | tert-butyl 2-diethoxyphosphorylacetate;tert-butyl 4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethylidene]piperidine-1-carboxylate;tert-butyl 4-oxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 160945142 |
| Molecular Formula | C36H65N2O12P |
| Molecular Weight | 748.89 g/mol |
| Exact Mass | 748.43 |
| IUPAC Name | tert-butyl 2-diethoxyphosphorylacetate;tert-butyl 4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethylidene]piperidine-1-carboxylate;tert-butyl 4-oxopiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)C=C1CCN(C(=O)OC(C)(C)C)CC1.CC(C)(C)OC(=O)N1CCC(=O)CC1.CCOP(=O)(CC(=O)OC(C)(C)C)OCC |
| InChI | InChI=1S/C16H27NO4.C10H17NO3.C10H21O5P/c1-15(2,3)20-13(18)11-12-7-9-17(10-8-12)14(19)21-16(4,5)6;1-10(2,3)14-9(13)11-6-4-8(12)5-7-11;1-6-13-16(12,14-7-2)8-9(11)15-10(3,4)5/h11H,7-10H2,1-6H3;4-7H2,1-3H3;6-8H2,1-5H3 |
| InChIKey | SUZZUMYIVBJELR-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 164.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.89 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|