C42H53Cl2N3O7 — CID 160947593
7-(4-chlorophenyl)-2-(morpholine-4-carbonyl)heptanoic acid;7-(4-chlorophenyl)-2-(4-phenylpiperazine-1-carbonyl)heptanoic acid (PubChem CID 160947593) has the molecular formula C42H53Cl2N3O7 and a molecular weight of 782.81 g/mol. Its IUPAC name is 7-(4-chlorophenyl)-2-(morpholine-4-carbonyl)heptanoic acid;7-(4-chlorophenyl)-2-(4-phenylpiperazine-1-carbonyl)heptanoic acid.
| Compound Name | 7-(4-chlorophenyl)-2-(morpholine-4-carbonyl)heptanoic acid;7-(4-chlorophenyl)-2-(4-phenylpiperazine-1-carbonyl)heptanoic acid |
|---|---|
| PubChem CID | 160947593 |
| Molecular Formula | C42H53Cl2N3O7 |
| Molecular Weight | 782.81 g/mol |
| Exact Mass | 781.33 |
| IUPAC Name | 7-(4-chlorophenyl)-2-(morpholine-4-carbonyl)heptanoic acid;7-(4-chlorophenyl)-2-(4-phenylpiperazine-1-carbonyl)heptanoic acid |
| SMILES | O=C(O)C(CCCCCc1ccc(Cl)cc1)C(=O)N1CCN(c2ccccc2)CC1.O=C(O)C(CCCCCc1ccc(Cl)cc1)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C24H29ClN2O3.C18H24ClNO4/c25-20-13-11-19(12-14-20)7-3-1-6-10-22(24(29)30)23(28)27-17-15-26(16-18-27)21-8-4-2-5-9-21;19-15-8-6-14(7-9-15)4-2-1-3-5-16(18(22)23)17(21)20-10-12-24-13-11-20/h2,4-5,8-9,11-14,22H,1,3,6-7,10,15-18H2,(H,29,30);6-9,16H,1-5,10-13H2,(H,22,23) |
| InChIKey | SVHZCWGEAJDVAG-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 127.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.81 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|