About 4-methylidene-1-propan-2-yl-5H-indole;1-propan-2-ylindole
4-methylidene-1-propan-2-yl-5H-indole;1-propan-2-ylindole (PubChem CID 160948660) has the molecular formula C23H28N2
and a molecular weight of 332.49 g/mol. Its IUPAC name is 4-methylidene-1-propan-2-yl-5H-indole;1-propan-2-ylindole.
Molecular Properties
| Compound Name | 4-methylidene-1-propan-2-yl-5H-indole;1-propan-2-ylindole |
| PubChem CID | 160948660 |
| Molecular Formula | C23H28N2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | 4-methylidene-1-propan-2-yl-5H-indole;1-propan-2-ylindole |
| SMILES | C=C1CC=Cc2c1ccn2C(C)C.CC(C)n1ccc2ccccc21 |
| InChI | InChI=1S/C12H15N.C11H13N/c1-9(2)13-8-7-11-10(3)5-4-6-12(11)13;1-9(2)12-8-7-10-5-3-4-6-11(10)12/h4,6-9H,3,5H2,1-2H3;3-9H,1-2H3 |
| InChIKey | SVLPJBPIBLKXDA-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methylidene-1-propan-2-yl-5H-indole;1-propan-2-ylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylidene-1-propan-2-yl-5H-indole;1-propan-2-ylindole?
The IUPAC name of 4-methylidene-1-propan-2-yl-5H-indole;1-propan-2-ylindole (CID 160948660) is 4-methylidene-1-propan-2-yl-5H-indole;1-propan-2-ylindole.
What is the SMILES notation for 4-methylidene-1-propan-2-yl-5H-indole;1-propan-2-ylindole?
The canonical SMILES for 4-methylidene-1-propan-2-yl-5H-indole;1-propan-2-ylindole is C=C1CC=Cc2c1ccn2C(C)C.CC(C)n1ccc2ccccc21.
What is the InChIKey of 4-methylidene-1-propan-2-yl-5H-indole;1-propan-2-ylindole?
The InChIKey is SVLPJBPIBLKXDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N.C11H13N/c1-9(2)13-8-7-11-10(3)5-4-6-12(11)13;1-9(2)12-8-7-10-5-3-4-6-11(10)12/h4,6-9H,3,5H2,1-2H3;3-9H,1-2H3.
What are the key properties of 4-methylidene-1-propan-2-yl-5H-indole;1-propan-2-ylindole?
4-methylidene-1-propan-2-yl-5H-indole;1-propan-2-ylindole has a molecular weight of 332.49 g/mol, XLogP of 6.72, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylidene-1-propan-2-yl-5H-indole;1-propan-2-ylindole is sourced from PubChem (CID 160948660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).