C39H45N3O6 — CID 160949012
(E)-N-hydroxy-3-[2-[[3-(3-hydroxypropyl)phenyl]methylamino]phenyl]prop-2-enamide;methyl (E)-3-[2-[[3-(3-hydroxypropyl)phenyl]methylamino]phenyl]prop-2-enoate (PubChem CID 160949012) has the molecular formula C39H45N3O6 and a molecular weight of 651.80 g/mol. Its IUPAC name is (E)-N-hydroxy-3-[2-[[3-(3-hydroxypropyl)phenyl]methylamino]phenyl]prop-2-enamide;methyl (E)-3-[2-[[3-(3-hydroxypropyl)phenyl]methylamino]phenyl]prop-2-enoate.
| Compound Name | (E)-N-hydroxy-3-[2-[[3-(3-hydroxypropyl)phenyl]methylamino]phenyl]prop-2-enamide;methyl (E)-3-[2-[[3-(3-hydroxypropyl)phenyl]methylamino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 160949012 |
| Molecular Formula | C39H45N3O6 |
| Molecular Weight | 651.80 g/mol |
| Exact Mass | 651.33 |
| IUPAC Name | (E)-N-hydroxy-3-[2-[[3-(3-hydroxypropyl)phenyl]methylamino]phenyl]prop-2-enamide;methyl (E)-3-[2-[[3-(3-hydroxypropyl)phenyl]methylamino]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccccc1NCc1cccc(CCCO)c1.O=C(/C=C/c1ccccc1NCc1cccc(CCCO)c1)NO |
| InChI | InChI=1S/C20H23NO3.C19H22N2O3/c1-24-20(23)12-11-18-9-2-3-10-19(18)21-15-17-7-4-6-16(14-17)8-5-13-22;22-12-4-7-15-5-3-6-16(13-15)14-20-18-9-2-1-8-17(18)10-11-19(23)21-24/h2-4,6-7,9-12,14,21-22H,5,8,13,15H2,1H3;1-3,5-6,8-11,13,20,22,24H,4,7,12,14H2,(H,21,23)/b12-11+;11-10+ |
| InChIKey | SVMTYARZBTXFJN-CXJFYUDPSA-N |
| XLogP | 6.15 |
| TPSA | 140.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.80 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|