C17H20N6O2 — CID 166920751
(E)-3-[2-[[4-[(Z)-N-aminocarbamohydrazonoyl]phenyl]methylamino]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 166920751) has the molecular formula C17H20N6O2 and a molecular weight of 340.39 g/mol. Its IUPAC name is (E)-3-[2-[[4-[(Z)-N-aminocarbamohydrazonoyl]phenyl]methylamino]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[2-[[4-[(Z)-N-aminocarbamohydrazonoyl]phenyl]methylamino]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 166920751 |
| Molecular Formula | C17H20N6O2 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | (E)-3-[2-[[4-[(Z)-N-aminocarbamohydrazonoyl]phenyl]methylamino]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | N/N=C(\NN)c1ccc(CNc2ccccc2/C=C/C(=O)NO)cc1 |
| InChI | InChI=1S/C17H20N6O2/c18-21-17(22-19)14-7-5-12(6-8-14)11-20-15-4-2-1-3-13(15)9-10-16(24)23-25/h1-10,20,25H,11,18-19H2,(H,21,22)(H,23,24)/b10-9+ |
| InChIKey | DRDJYDBSWJMGTM-MDZDMXLPSA-N |
| XLogP | 0.90 |
| TPSA | 137.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|